C12H13ClINO — CID 114304978
N-(2-chloro-2-cyclopropylethyl)-4-iodobenzamide (PubChem CID 114304978) has the molecular formula C12H13ClINO and a molecular weight of 349.60 g/mol. Its IUPAC name is N-(2-chloro-2-cyclopropylethyl)-4-iodobenzamide.
| Compound Name | N-(2-chloro-2-cyclopropylethyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 114304978 |
| Molecular Formula | C12H13ClINO |
| Molecular Weight | 349.60 g/mol |
| Exact Mass | 348.97 |
| IUPAC Name | N-(2-chloro-2-cyclopropylethyl)-4-iodobenzamide |
| SMILES | O=C(NCC(Cl)C1CC1)c1ccc(I)cc1 |
| InChI | InChI=1S/C12H13ClINO/c13-11(8-1-2-8)7-15-12(16)9-3-5-10(14)6-4-9/h3-6,8,11H,1-2,7H2,(H,15,16) |
| InChIKey | MJGOMOGENRDEJO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.60 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|