C11H14INO3 — CID 10903782
N-(2,2-dimethoxyethyl)-4-iodobenzamide (PubChem CID 10903782) has the molecular formula C11H14INO3 and a molecular weight of 335.14 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-4-iodobenzamide.
| Compound Name | N-(2,2-dimethoxyethyl)-4-iodobenzamide |
|---|---|
| PubChem CID | 10903782 |
| Molecular Formula | C11H14INO3 |
| Molecular Weight | 335.14 g/mol |
| Exact Mass | 335.00 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-4-iodobenzamide |
| SMILES | COC(CNC(=O)c1ccc(I)cc1)OC |
| InChI | InChI=1S/C11H14INO3/c1-15-10(16-2)7-13-11(14)8-3-5-9(12)6-4-8/h3-6,10H,7H2,1-2H3,(H,13,14) |
| InChIKey | FKSHNXIYANGOFX-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.14 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|