C13H18N2O3 — CID 103998690
N-(2,2-dimethoxyethyl)-2,3-dihydro-1H-isoindole-5-carboxamide (PubChem CID 103998690) has the molecular formula C13H18N2O3 and a molecular weight of 250.30 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-2,3-dihydro-1H-isoindole-5-carboxamide.
| Compound Name | N-(2,2-dimethoxyethyl)-2,3-dihydro-1H-isoindole-5-carboxamide |
|---|---|
| PubChem CID | 103998690 |
| Molecular Formula | C13H18N2O3 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-2,3-dihydro-1H-isoindole-5-carboxamide |
| SMILES | COC(CNC(=O)c1ccc2c(c1)CNC2)OC |
| InChI | InChI=1S/C13H18N2O3/c1-17-12(18-2)8-15-13(16)9-3-4-10-6-14-7-11(10)5-9/h3-5,12,14H,6-8H2,1-2H3,(H,15,16) |
| InChIKey | CXUARZAQGFZYSG-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|