C10H11Cl2NO2 — CID 106690017
2-chloro-N-(2-chloro-2-cyclopropylethyl)furan-3-carboxamide (PubChem CID 106690017) has the molecular formula C10H11Cl2NO2 and a molecular weight of 248.11 g/mol. Its IUPAC name is 2-chloro-N-(2-chloro-2-cyclopropylethyl)furan-3-carboxamide.
| Compound Name | 2-chloro-N-(2-chloro-2-cyclopropylethyl)furan-3-carboxamide |
|---|---|
| PubChem CID | 106690017 |
| Molecular Formula | C10H11Cl2NO2 |
| Molecular Weight | 248.11 g/mol |
| Exact Mass | 247.02 |
| IUPAC Name | 2-chloro-N-(2-chloro-2-cyclopropylethyl)furan-3-carboxamide |
| SMILES | O=C(NCC(Cl)C1CC1)c1ccoc1Cl |
| InChI | InChI=1S/C10H11Cl2NO2/c11-8(6-1-2-6)5-13-10(14)7-3-4-15-9(7)12/h3-4,6,8H,1-2,5H2,(H,13,14) |
| InChIKey | RHUSCSXRIFRTQO-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.11 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|