C11H14N2O3 — CID 63851883
N-(2-cyclopropyl-2-hydroxyethyl)-5-hydroxypyridine-3-carboxamide (PubChem CID 63851883) has the molecular formula C11H14N2O3 and a molecular weight of 222.24 g/mol. Its IUPAC name is N-(2-cyclopropyl-2-hydroxyethyl)-5-hydroxypyridine-3-carboxamide.
| Compound Name | N-(2-cyclopropyl-2-hydroxyethyl)-5-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 63851883 |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | N-(2-cyclopropyl-2-hydroxyethyl)-5-hydroxypyridine-3-carboxamide |
| SMILES | O=C(NCC(O)C1CC1)c1cncc(O)c1 |
| InChI | InChI=1S/C11H14N2O3/c14-9-3-8(4-12-5-9)11(16)13-6-10(15)7-1-2-7/h3-5,7,10,14-15H,1-2,6H2,(H,13,16) |
| InChIKey | WQLOSQKXADDRDV-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 82.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |