C8H8N2O4 — CID 770223
2-[(5-hydroxypyridine-3-carbonyl)amino]acetic acid (PubChem CID 770223) has the molecular formula C8H8N2O4 and a molecular weight of 196.16 g/mol. Its IUPAC name is 2-[(5-hydroxypyridine-3-carbonyl)amino]acetic acid.
| Compound Name | 2-[(5-hydroxypyridine-3-carbonyl)amino]acetic acid |
|---|---|
| PubChem CID | 770223 |
| Molecular Formula | C8H8N2O4 |
| Molecular Weight | 196.16 g/mol |
| Exact Mass | 196.05 |
| IUPAC Name | 2-[(5-hydroxypyridine-3-carbonyl)amino]acetic acid |
| SMILES | O=C(O)CNC(=O)c1cncc(O)c1 |
| InChI | InChI=1S/C8H8N2O4/c11-6-1-5(2-9-3-6)8(14)10-4-7(12)13/h1-3,11H,4H2,(H,10,14)(H,12,13) |
| InChIKey | CVOJDRRKJPJPOM-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 99.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |