C10H14N2O3S — CID 115633331
N-(2-ethylsulfinylethyl)-5-hydroxypyridine-3-carboxamide (PubChem CID 115633331) has the molecular formula C10H14N2O3S and a molecular weight of 242.30 g/mol. Its IUPAC name is N-(2-ethylsulfinylethyl)-5-hydroxypyridine-3-carboxamide.
| Compound Name | N-(2-ethylsulfinylethyl)-5-hydroxypyridine-3-carboxamide |
|---|---|
| PubChem CID | 115633331 |
| Molecular Formula | C10H14N2O3S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | N-(2-ethylsulfinylethyl)-5-hydroxypyridine-3-carboxamide |
| SMILES | CCS(=O)CCNC(=O)c1cncc(O)c1 |
| InChI | InChI=1S/C10H14N2O3S/c1-2-16(15)4-3-12-10(14)8-5-9(13)7-11-6-8/h5-7,13H,2-4H2,1H3,(H,12,14) |
| InChIKey | WPOKWUYPVIBZSB-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |