C10H11Cl2NO3S — CID 129365592
(3R,4R)-4-(2,4-dichloroanilino)-1,1-dioxothiolan-3-ol (PubChem CID 129365592) has the molecular formula C10H11Cl2NO3S and a molecular weight of 296.18 g/mol. Its IUPAC name is (3R,4R)-4-(2,4-dichloroanilino)-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4R)-4-(2,4-dichloroanilino)-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 129365592 |
| Molecular Formula | C10H11Cl2NO3S |
| Molecular Weight | 296.18 g/mol |
| Exact Mass | 294.98 |
| IUPAC Name | (3R,4R)-4-(2,4-dichloroanilino)-1,1-dioxothiolan-3-ol |
| SMILES | O=S1(=O)C[C@H](Nc2ccc(Cl)cc2Cl)[C@@H](O)C1 |
| InChI | InChI=1S/C10H11Cl2NO3S/c11-6-1-2-8(7(12)3-6)13-9-4-17(15,16)5-10(9)14/h1-3,9-10,13-14H,4-5H2/t9-,10-/m0/s1 |
| InChIKey | IRDNHQZIEZNBID-UWVGGRQHSA-N |
| XLogP | 1.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |