C14H19Cl2N3O4S — CID 164663413
N-(2,5-dichlorophenyl)-2-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethylamino]acetamide (PubChem CID 164663413) has the molecular formula C14H19Cl2N3O4S and a molecular weight of 396.30 g/mol. Its IUPAC name is N-(2,5-dichlorophenyl)-2-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethylamino]acetamide.
| Compound Name | N-(2,5-dichlorophenyl)-2-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethylamino]acetamide |
|---|---|
| PubChem CID | 164663413 |
| Molecular Formula | C14H19Cl2N3O4S |
| Molecular Weight | 396.30 g/mol |
| Exact Mass | 395.05 |
| IUPAC Name | N-(2,5-dichlorophenyl)-2-[2-[(4-hydroxy-1,1-dioxothiolan-3-yl)amino]ethylamino]acetamide |
| SMILES | O=C(CNCCNC1CS(=O)(=O)CC1O)Nc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H19Cl2N3O4S/c15-9-1-2-10(16)11(5-9)19-14(21)6-17-3-4-18-12-7-24(22,23)8-13(12)20/h1-2,5,12-13,17-18,20H,3-4,6-8H2,(H,19,21) |
| InChIKey | WLHQJOSKOYEQFS-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 107.53 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.30 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|