C14H17ClN2O3 — CID 71972988
methyl 2-[(2-chlorophenyl)carbamoylamino]cyclopentane-1-carboxylate (PubChem CID 71972988) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is methyl 2-[(2-chlorophenyl)carbamoylamino]cyclopentane-1-carboxylate.
| Compound Name | methyl 2-[(2-chlorophenyl)carbamoylamino]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 71972988 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | methyl 2-[(2-chlorophenyl)carbamoylamino]cyclopentane-1-carboxylate |
| SMILES | COC(=O)C1CCCC1NC(=O)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H17ClN2O3/c1-20-13(18)9-5-4-8-11(9)16-14(19)17-12-7-3-2-6-10(12)15/h2-3,6-7,9,11H,4-5,8H2,1H3,(H2,16,17,19) |
| InChIKey | ZEDBEEZMQYXJEN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |