C15H21N3O4 — CID 71857049
methyl 2-[(2-methoxy-3-pyridinyl)carbamoylamino]cyclohexane-1-carboxylate (PubChem CID 71857049) has the molecular formula C15H21N3O4 and a molecular weight of 307.35 g/mol. Its IUPAC name is methyl 2-[(2-methoxy-3-pyridinyl)carbamoylamino]cyclohexane-1-carboxylate.
| Compound Name | methyl 2-[(2-methoxy-3-pyridinyl)carbamoylamino]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 71857049 |
| Molecular Formula | C15H21N3O4 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.15 |
| IUPAC Name | methyl 2-[(2-methoxy-3-pyridinyl)carbamoylamino]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCCCC1NC(=O)Nc1cccnc1OC |
| InChI | InChI=1S/C15H21N3O4/c1-21-13-12(8-5-9-16-13)18-15(20)17-11-7-4-3-6-10(11)14(19)22-2/h5,8-11H,3-4,6-7H2,1-2H3,(H2,17,18,20) |
| InChIKey | VHHDXKOLZNGYNZ-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |