C13H18N4O3 — CID 94030553
1-(2-methoxy-3-pyridinyl)-3-[(3S)-2-oxoazepan-3-yl]urea (PubChem CID 94030553) has the molecular formula C13H18N4O3 and a molecular weight of 278.31 g/mol. Its IUPAC name is 1-(2-methoxy-3-pyridinyl)-3-[(3S)-2-oxoazepan-3-yl]urea.
| Compound Name | 1-(2-methoxy-3-pyridinyl)-3-[(3S)-2-oxoazepan-3-yl]urea |
|---|---|
| PubChem CID | 94030553 |
| Molecular Formula | C13H18N4O3 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 1-(2-methoxy-3-pyridinyl)-3-[(3S)-2-oxoazepan-3-yl]urea |
| SMILES | COc1ncccc1NC(=O)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C13H18N4O3/c1-20-12-10(6-4-8-15-12)17-13(19)16-9-5-2-3-7-14-11(9)18/h4,6,8-9H,2-3,5,7H2,1H3,(H,14,18)(H2,16,17,19)/t9-/m0/s1 |
| InChIKey | BJEWFCNYMKBUQD-VIFPVBQESA-N |
| XLogP | 0.88 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |