C16H22FN3O3 — CID 95601505
1-(2-fluoro-4-propan-2-yloxyphenyl)-3-[(3R)-2-oxoazepan-3-yl]urea (PubChem CID 95601505) has the molecular formula C16H22FN3O3 and a molecular weight of 323.37 g/mol. Its IUPAC name is 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-[(3R)-2-oxoazepan-3-yl]urea.
| Compound Name | 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-[(3R)-2-oxoazepan-3-yl]urea |
|---|---|
| PubChem CID | 95601505 |
| Molecular Formula | C16H22FN3O3 |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.16 |
| IUPAC Name | 1-(2-fluoro-4-propan-2-yloxyphenyl)-3-[(3R)-2-oxoazepan-3-yl]urea |
| SMILES | CC(C)Oc1ccc(NC(=O)N[C@@H]2CCCCNC2=O)c(F)c1 |
| InChI | InChI=1S/C16H22FN3O3/c1-10(2)23-11-6-7-13(12(17)9-11)19-16(22)20-14-5-3-4-8-18-15(14)21/h6-7,9-10,14H,3-5,8H2,1-2H3,(H,18,21)(H2,19,20,22)/t14-/m1/s1 |
| InChIKey | JPKIWXHWORKIHX-CQSZACIVSA-N |
| XLogP | 2.40 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |