C18H27N3O2S — CID 95601510
1-(4-tert-butylsulfanyl-2-methylphenyl)-3-[(3S)-2-oxoazepan-3-yl]urea (PubChem CID 95601510) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-(4-tert-butylsulfanyl-2-methylphenyl)-3-[(3S)-2-oxoazepan-3-yl]urea.
| Compound Name | 1-(4-tert-butylsulfanyl-2-methylphenyl)-3-[(3S)-2-oxoazepan-3-yl]urea |
|---|---|
| PubChem CID | 95601510 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-(4-tert-butylsulfanyl-2-methylphenyl)-3-[(3S)-2-oxoazepan-3-yl]urea |
| SMILES | Cc1cc(SC(C)(C)C)ccc1NC(=O)N[C@H]1CCCCNC1=O |
| InChI | InChI=1S/C18H27N3O2S/c1-12-11-13(24-18(2,3)4)8-9-14(12)20-17(23)21-15-7-5-6-10-19-16(15)22/h8-9,11,15H,5-7,10H2,1-4H3,(H,19,22)(H2,20,21,23)/t15-/m0/s1 |
| InChIKey | QPQVXPZNFFONLU-HNNXBMFYSA-N |
| XLogP | 3.68 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |