C15H20N4O3S — CID 86807550
1-(4-tert-butylsulfanyl-2-methylphenyl)-3-(2,4-dioxoimidazolidin-1-yl)urea (PubChem CID 86807550) has the molecular formula C15H20N4O3S and a molecular weight of 336.42 g/mol. Its IUPAC name is 1-(4-tert-butylsulfanyl-2-methylphenyl)-3-(2,4-dioxoimidazolidin-1-yl)urea.
| Compound Name | 1-(4-tert-butylsulfanyl-2-methylphenyl)-3-(2,4-dioxoimidazolidin-1-yl)urea |
|---|---|
| PubChem CID | 86807550 |
| Molecular Formula | C15H20N4O3S |
| Molecular Weight | 336.42 g/mol |
| Exact Mass | 336.13 |
| IUPAC Name | 1-(4-tert-butylsulfanyl-2-methylphenyl)-3-(2,4-dioxoimidazolidin-1-yl)urea |
| SMILES | Cc1cc(SC(C)(C)C)ccc1NC(=O)NN1CC(=O)NC1=O |
| InChI | InChI=1S/C15H20N4O3S/c1-9-7-10(23-15(2,3)4)5-6-11(9)16-13(21)18-19-8-12(20)17-14(19)22/h5-7H,8H2,1-4H3,(H2,16,18,21)(H,17,20,22) |
| InChIKey | MURVDBAWFXTTGA-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 90.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.42 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|