C17H20N2OS2 — CID 166232180
(E)-N-(4-tert-butylsulfanyl-2-methylphenyl)-3-(1,3-thiazol-5-yl)prop-2-enamide (PubChem CID 166232180) has the molecular formula C17H20N2OS2 and a molecular weight of 332.49 g/mol. Its IUPAC name is (E)-N-(4-tert-butylsulfanyl-2-methylphenyl)-3-(1,3-thiazol-5-yl)prop-2-enamide.
| Compound Name | (E)-N-(4-tert-butylsulfanyl-2-methylphenyl)-3-(1,3-thiazol-5-yl)prop-2-enamide |
|---|---|
| PubChem CID | 166232180 |
| Molecular Formula | C17H20N2OS2 |
| Molecular Weight | 332.49 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | (E)-N-(4-tert-butylsulfanyl-2-methylphenyl)-3-(1,3-thiazol-5-yl)prop-2-enamide |
| SMILES | Cc1cc(SC(C)(C)C)ccc1NC(=O)/C=C/c1cncs1 |
| InChI | InChI=1S/C17H20N2OS2/c1-12-9-13(22-17(2,3)4)5-7-15(12)19-16(20)8-6-14-10-18-11-21-14/h5-11H,1-4H3,(H,19,20)/b8-6+ |
| InChIKey | FHLADVXUBTXMIM-SOFGYWHQSA-N |
| XLogP | 4.99 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.49 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|