C18H23ClN2OS — CID 119765605
3-amino-N-(4-tert-butylsulfanyl-2-methylphenyl)benzamide;hydrochloride (PubChem CID 119765605) has the molecular formula C18H23ClN2OS and a molecular weight of 350.92 g/mol. Its IUPAC name is 3-amino-N-(4-tert-butylsulfanyl-2-methylphenyl)benzamide;hydrochloride.
| Compound Name | 3-amino-N-(4-tert-butylsulfanyl-2-methylphenyl)benzamide;hydrochloride |
|---|---|
| PubChem CID | 119765605 |
| Molecular Formula | C18H23ClN2OS |
| Molecular Weight | 350.92 g/mol |
| Exact Mass | 350.12 |
| IUPAC Name | 3-amino-N-(4-tert-butylsulfanyl-2-methylphenyl)benzamide;hydrochloride |
| SMILES | Cc1cc(SC(C)(C)C)ccc1NC(=O)c1cccc(N)c1.Cl |
| InChI | InChI=1S/C18H22N2OS.ClH/c1-12-10-15(22-18(2,3)4)8-9-16(12)20-17(21)13-6-5-7-14(19)11-13;/h5-11H,19H2,1-4H3,(H,20,21);1H |
| InChIKey | AKGCOJQEJBQCBN-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.92 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|