C16H27ClN2OS — CID 120561921
4-amino-N-(4-tert-butylsulfanyl-2-methylphenyl)pentanamide;hydrochloride (PubChem CID 120561921) has the molecular formula C16H27ClN2OS and a molecular weight of 330.93 g/mol. Its IUPAC name is 4-amino-N-(4-tert-butylsulfanyl-2-methylphenyl)pentanamide;hydrochloride.
| Compound Name | 4-amino-N-(4-tert-butylsulfanyl-2-methylphenyl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120561921 |
| Molecular Formula | C16H27ClN2OS |
| Molecular Weight | 330.93 g/mol |
| Exact Mass | 330.15 |
| IUPAC Name | 4-amino-N-(4-tert-butylsulfanyl-2-methylphenyl)pentanamide;hydrochloride |
| SMILES | Cc1cc(SC(C)(C)C)ccc1NC(=O)CCC(C)N.Cl |
| InChI | InChI=1S/C16H26N2OS.ClH/c1-11-10-13(20-16(3,4)5)7-8-14(11)18-15(19)9-6-12(2)17;/h7-8,10,12H,6,9,17H2,1-5H3,(H,18,19);1H |
| InChIKey | FBTJEJBBYFXVKN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.93 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |