C18H29ClN2OS — CID 120561649
4-amino-N-(4-cyclohexylsulfanyl-2-methylphenyl)pentanamide;hydrochloride (PubChem CID 120561649) has the molecular formula C18H29ClN2OS and a molecular weight of 356.96 g/mol. Its IUPAC name is 4-amino-N-(4-cyclohexylsulfanyl-2-methylphenyl)pentanamide;hydrochloride.
| Compound Name | 4-amino-N-(4-cyclohexylsulfanyl-2-methylphenyl)pentanamide;hydrochloride |
|---|---|
| PubChem CID | 120561649 |
| Molecular Formula | C18H29ClN2OS |
| Molecular Weight | 356.96 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 4-amino-N-(4-cyclohexylsulfanyl-2-methylphenyl)pentanamide;hydrochloride |
| SMILES | Cc1cc(SC2CCCCC2)ccc1NC(=O)CCC(C)N.Cl |
| InChI | InChI=1S/C18H28N2OS.ClH/c1-13-12-16(22-15-6-4-3-5-7-15)9-10-17(13)20-18(21)11-8-14(2)19;/h9-10,12,14-15H,3-8,11,19H2,1-2H3,(H,20,21);1H |
| InChIKey | JJAAOUHKACCXGR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.96 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |