C20H23BrN2O3S2 — CID 60608333
2-bromo-N-(4-cyclohexylsulfanyl-2-methylphenyl)-5-sulfamoylbenzamide (PubChem CID 60608333) has the molecular formula C20H23BrN2O3S2 and a molecular weight of 483.45 g/mol. Its IUPAC name is 2-bromo-N-(4-cyclohexylsulfanyl-2-methylphenyl)-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-(4-cyclohexylsulfanyl-2-methylphenyl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 60608333 |
| Molecular Formula | C20H23BrN2O3S2 |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 482.03 |
| IUPAC Name | 2-bromo-N-(4-cyclohexylsulfanyl-2-methylphenyl)-5-sulfamoylbenzamide |
| SMILES | Cc1cc(SC2CCCCC2)ccc1NC(=O)c1cc(S(N)(=O)=O)ccc1Br |
| InChI | InChI=1S/C20H23BrN2O3S2/c1-13-11-15(27-14-5-3-2-4-6-14)7-10-19(13)23-20(24)17-12-16(28(22,25)26)8-9-18(17)21/h7-12,14H,2-6H2,1H3,(H,23,24)(H2,22,25,26) |
| InChIKey | YRYPGIKQDPSKDC-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |