C12H15BrN2O4S2 — CID 115886717
2-bromo-N-(1-oxothian-4-yl)-5-sulfamoylbenzamide (PubChem CID 115886717) has the molecular formula C12H15BrN2O4S2 and a molecular weight of 395.30 g/mol. Its IUPAC name is 2-bromo-N-(1-oxothian-4-yl)-5-sulfamoylbenzamide.
| Compound Name | 2-bromo-N-(1-oxothian-4-yl)-5-sulfamoylbenzamide |
|---|---|
| PubChem CID | 115886717 |
| Molecular Formula | C12H15BrN2O4S2 |
| Molecular Weight | 395.30 g/mol |
| Exact Mass | 393.97 |
| IUPAC Name | 2-bromo-N-(1-oxothian-4-yl)-5-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(Br)c(C(=O)NC2CCS(=O)CC2)c1 |
| InChI | InChI=1S/C12H15BrN2O4S2/c13-11-2-1-9(21(14,18)19)7-10(11)12(16)15-8-3-5-20(17)6-4-8/h1-2,7-8H,3-6H2,(H,15,16)(H2,14,18,19) |
| InChIKey | MIWMIFHDOAQIKG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 106.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.30 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |