C12H18N2O3S2 — CID 54981628
4-methyl-3-[(1-oxothian-4-yl)amino]benzenesulfonamide (PubChem CID 54981628) has the molecular formula C12H18N2O3S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is 4-methyl-3-[(1-oxothian-4-yl)amino]benzenesulfonamide.
| Compound Name | 4-methyl-3-[(1-oxothian-4-yl)amino]benzenesulfonamide |
|---|---|
| PubChem CID | 54981628 |
| Molecular Formula | C12H18N2O3S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | 4-methyl-3-[(1-oxothian-4-yl)amino]benzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NC1CCS(=O)CC1 |
| InChI | InChI=1S/C12H18N2O3S2/c1-9-2-3-11(19(13,16)17)8-12(9)14-10-4-6-18(15)7-5-10/h2-3,8,10,14H,4-7H2,1H3,(H2,13,16,17) |
| InChIKey | MTELWRFOABKXSA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |