C15H24N2O2S — CID 64753179
3-[(3,5-dimethylcyclohexyl)amino]-4-methylbenzenesulfonamide (PubChem CID 64753179) has the molecular formula C15H24N2O2S and a molecular weight of 296.44 g/mol. Its IUPAC name is 3-[(3,5-dimethylcyclohexyl)amino]-4-methylbenzenesulfonamide.
| Compound Name | 3-[(3,5-dimethylcyclohexyl)amino]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 64753179 |
| Molecular Formula | C15H24N2O2S |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | 3-[(3,5-dimethylcyclohexyl)amino]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(N)(=O)=O)cc1NC1CC(C)CC(C)C1 |
| InChI | InChI=1S/C15H24N2O2S/c1-10-6-11(2)8-13(7-10)17-15-9-14(20(16,18)19)5-4-12(15)3/h4-5,9-11,13,17H,6-8H2,1-3H3,(H2,16,18,19) |
| InChIKey | BQKYWMBZEWGDPN-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |