C17H27NO2S — CID 43685145
2-methyl-5-methylsulfonyl-N-(3,3,5-trimethylcyclohexyl)aniline (PubChem CID 43685145) has the molecular formula C17H27NO2S and a molecular weight of 309.48 g/mol. Its IUPAC name is 2-methyl-5-methylsulfonyl-N-(3,3,5-trimethylcyclohexyl)aniline.
| Compound Name | 2-methyl-5-methylsulfonyl-N-(3,3,5-trimethylcyclohexyl)aniline |
|---|---|
| PubChem CID | 43685145 |
| Molecular Formula | C17H27NO2S |
| Molecular Weight | 309.48 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 2-methyl-5-methylsulfonyl-N-(3,3,5-trimethylcyclohexyl)aniline |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1NC1CC(C)CC(C)(C)C1 |
| InChI | InChI=1S/C17H27NO2S/c1-12-8-14(11-17(3,4)10-12)18-16-9-15(21(5,19)20)7-6-13(16)2/h6-7,9,12,14,18H,8,10-11H2,1-5H3 |
| InChIKey | ZASGNIPAAFCJDX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.48 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |