C12H13Br2NO2S — CID 104580877
2,4-dibromo-N-(1-oxothian-4-yl)benzamide (PubChem CID 104580877) has the molecular formula C12H13Br2NO2S and a molecular weight of 395.12 g/mol. Its IUPAC name is 2,4-dibromo-N-(1-oxothian-4-yl)benzamide.
| Compound Name | 2,4-dibromo-N-(1-oxothian-4-yl)benzamide |
|---|---|
| PubChem CID | 104580877 |
| Molecular Formula | C12H13Br2NO2S |
| Molecular Weight | 395.12 g/mol |
| Exact Mass | 392.90 |
| IUPAC Name | 2,4-dibromo-N-(1-oxothian-4-yl)benzamide |
| SMILES | O=C(NC1CCS(=O)CC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C12H13Br2NO2S/c13-8-1-2-10(11(14)7-8)12(16)15-9-3-5-18(17)6-4-9/h1-2,7,9H,3-6H2,(H,15,16) |
| InChIKey | ZIFFAJAYIJNTCS-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.12 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |