C11H11Br2NO2 — CID 107939661
2,4-dibromo-N-(3-hydroxycyclobutyl)benzamide (PubChem CID 107939661) has the molecular formula C11H11Br2NO2 and a molecular weight of 349.02 g/mol. Its IUPAC name is 2,4-dibromo-N-(3-hydroxycyclobutyl)benzamide.
| Compound Name | 2,4-dibromo-N-(3-hydroxycyclobutyl)benzamide |
|---|---|
| PubChem CID | 107939661 |
| Molecular Formula | C11H11Br2NO2 |
| Molecular Weight | 349.02 g/mol |
| Exact Mass | 346.92 |
| IUPAC Name | 2,4-dibromo-N-(3-hydroxycyclobutyl)benzamide |
| SMILES | O=C(NC1CC(O)C1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C11H11Br2NO2/c12-6-1-2-9(10(13)3-6)11(16)14-7-4-8(15)5-7/h1-3,7-8,15H,4-5H2,(H,14,16) |
| InChIKey | VOYUCSAOLOLTHO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.02 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |