C13H14Br2ClNO — CID 107941133
2,4-dibromo-N-(4-chlorocyclohexyl)benzamide (PubChem CID 107941133) has the molecular formula C13H14Br2ClNO and a molecular weight of 395.52 g/mol. Its IUPAC name is 2,4-dibromo-N-(4-chlorocyclohexyl)benzamide.
| Compound Name | 2,4-dibromo-N-(4-chlorocyclohexyl)benzamide |
|---|---|
| PubChem CID | 107941133 |
| Molecular Formula | C13H14Br2ClNO |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 392.91 |
| IUPAC Name | 2,4-dibromo-N-(4-chlorocyclohexyl)benzamide |
| SMILES | O=C(NC1CCC(Cl)CC1)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H14Br2ClNO/c14-8-1-6-11(12(15)7-8)13(18)17-10-4-2-9(16)3-5-10/h1,6-7,9-10H,2-5H2,(H,17,18) |
| InChIKey | YIKLKJWBMZCZCO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|