C13H14Br2N2OS — CID 107938989
2,4-dibromo-N-(2-carbamothioylcyclopentyl)benzamide (PubChem CID 107938989) has the molecular formula C13H14Br2N2OS and a molecular weight of 406.14 g/mol. Its IUPAC name is 2,4-dibromo-N-(2-carbamothioylcyclopentyl)benzamide.
| Compound Name | 2,4-dibromo-N-(2-carbamothioylcyclopentyl)benzamide |
|---|---|
| PubChem CID | 107938989 |
| Molecular Formula | C13H14Br2N2OS |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 403.92 |
| IUPAC Name | 2,4-dibromo-N-(2-carbamothioylcyclopentyl)benzamide |
| SMILES | NC(=S)C1CCCC1NC(=O)c1ccc(Br)cc1Br |
| InChI | InChI=1S/C13H14Br2N2OS/c14-7-4-5-8(10(15)6-7)13(18)17-11-3-1-2-9(11)12(16)19/h4-6,9,11H,1-3H2,(H2,16,19)(H,17,18) |
| InChIKey | CHZQKPBJHYXBNG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|