C13H14BrFN2OS — CID 114559262
2-bromo-N-(2-carbamothioylcyclopentyl)-6-fluorobenzamide (PubChem CID 114559262) has the molecular formula C13H14BrFN2OS and a molecular weight of 345.24 g/mol. Its IUPAC name is 2-bromo-N-(2-carbamothioylcyclopentyl)-6-fluorobenzamide.
| Compound Name | 2-bromo-N-(2-carbamothioylcyclopentyl)-6-fluorobenzamide |
|---|---|
| PubChem CID | 114559262 |
| Molecular Formula | C13H14BrFN2OS |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.00 |
| IUPAC Name | 2-bromo-N-(2-carbamothioylcyclopentyl)-6-fluorobenzamide |
| SMILES | NC(=S)C1CCCC1NC(=O)c1c(F)cccc1Br |
| InChI | InChI=1S/C13H14BrFN2OS/c14-8-4-2-5-9(15)11(8)13(18)17-10-6-1-3-7(10)12(16)19/h2,4-5,7,10H,1,3,6H2,(H2,16,19)(H,17,18) |
| InChIKey | DEMOZIHAJZRATE-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|