C13H14ClFN2OS — CID 55151966
N-(2-carbamothioylcyclopentyl)-2-chloro-6-fluorobenzamide (PubChem CID 55151966) has the molecular formula C13H14ClFN2OS and a molecular weight of 300.79 g/mol. Its IUPAC name is N-(2-carbamothioylcyclopentyl)-2-chloro-6-fluorobenzamide.
| Compound Name | N-(2-carbamothioylcyclopentyl)-2-chloro-6-fluorobenzamide |
|---|---|
| PubChem CID | 55151966 |
| Molecular Formula | C13H14ClFN2OS |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | N-(2-carbamothioylcyclopentyl)-2-chloro-6-fluorobenzamide |
| SMILES | NC(=S)C1CCCC1NC(=O)c1c(F)cccc1Cl |
| InChI | InChI=1S/C13H14ClFN2OS/c14-8-4-2-5-9(15)11(8)13(18)17-10-6-1-3-7(10)12(16)19/h2,4-5,7,10H,1,3,6H2,(H2,16,19)(H,17,18) |
| InChIKey | WGIADCYRXREFJY-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|