C12H12BrF2NO2S — CID 104580801
4-bromo-2,6-difluoro-N-(1-oxothian-4-yl)benzamide (PubChem CID 104580801) has the molecular formula C12H12BrF2NO2S and a molecular weight of 352.20 g/mol. Its IUPAC name is 4-bromo-2,6-difluoro-N-(1-oxothian-4-yl)benzamide.
| Compound Name | 4-bromo-2,6-difluoro-N-(1-oxothian-4-yl)benzamide |
|---|---|
| PubChem CID | 104580801 |
| Molecular Formula | C12H12BrF2NO2S |
| Molecular Weight | 352.20 g/mol |
| Exact Mass | 350.97 |
| IUPAC Name | 4-bromo-2,6-difluoro-N-(1-oxothian-4-yl)benzamide |
| SMILES | O=C(NC1CCS(=O)CC1)c1c(F)cc(Br)cc1F |
| InChI | InChI=1S/C12H12BrF2NO2S/c13-7-5-9(14)11(10(15)6-7)12(17)16-8-1-3-19(18)4-2-8/h5-6,8H,1-4H2,(H,16,17) |
| InChIKey | GSGNOJUYSFTWDR-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |