C13H14F3NO2 — CID 65100669
2,4,6-trifluoro-N-(4-hydroxycyclohexyl)benzamide (PubChem CID 65100669) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is 2,4,6-trifluoro-N-(4-hydroxycyclohexyl)benzamide.
| Compound Name | 2,4,6-trifluoro-N-(4-hydroxycyclohexyl)benzamide |
|---|---|
| PubChem CID | 65100669 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | 2,4,6-trifluoro-N-(4-hydroxycyclohexyl)benzamide |
| SMILES | O=C(NC1CCC(O)CC1)c1c(F)cc(F)cc1F |
| InChI | InChI=1S/C13H14F3NO2/c14-7-5-10(15)12(11(16)6-7)13(19)17-8-1-3-9(18)4-2-8/h5-6,8-9,18H,1-4H2,(H,17,19) |
| InChIKey | UQHPYQNAZUNEKO-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |