C13H15F3N2OS — CID 157169520
1-(4-hydroxycyclohexyl)-3-(2,4,6-trifluorophenyl)thiourea (PubChem CID 157169520) has the molecular formula C13H15F3N2OS and a molecular weight of 304.34 g/mol. Its IUPAC name is 1-(4-hydroxycyclohexyl)-3-(2,4,6-trifluorophenyl)thiourea.
| Compound Name | 1-(4-hydroxycyclohexyl)-3-(2,4,6-trifluorophenyl)thiourea |
|---|---|
| PubChem CID | 157169520 |
| Molecular Formula | C13H15F3N2OS |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 1-(4-hydroxycyclohexyl)-3-(2,4,6-trifluorophenyl)thiourea |
| SMILES | OC1CCC(NC(=S)Nc2c(F)cc(F)cc2F)CC1 |
| InChI | InChI=1S/C13H15F3N2OS/c14-7-5-10(15)12(11(16)6-7)18-13(20)17-8-1-3-9(19)4-2-8/h5-6,8-9,19H,1-4H2,(H2,17,18,20) |
| InChIKey | ANHKAMHLJMNVCR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 44.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|