C12H16F2N2O — CID 54902753
4-(4-amino-2,6-difluoroanilino)cyclohexan-1-ol (PubChem CID 54902753) has the molecular formula C12H16F2N2O and a molecular weight of 242.27 g/mol. Its IUPAC name is 4-(4-amino-2,6-difluoroanilino)cyclohexan-1-ol.
| Compound Name | 4-(4-amino-2,6-difluoroanilino)cyclohexan-1-ol |
|---|---|
| PubChem CID | 54902753 |
| Molecular Formula | C12H16F2N2O |
| Molecular Weight | 242.27 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-(4-amino-2,6-difluoroanilino)cyclohexan-1-ol |
| SMILES | Nc1cc(F)c(NC2CCC(O)CC2)c(F)c1 |
| InChI | InChI=1S/C12H16F2N2O/c13-10-5-7(15)6-11(14)12(10)16-8-1-3-9(17)4-2-8/h5-6,8-9,16-17H,1-4,15H2 |
| InChIKey | KOTHWRFJYSUADF-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.27 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|