C13H17NO4S2 — CID 60872682
2-cyclohexylsulfanyl-5-sulfamoylbenzoic acid (PubChem CID 60872682) has the molecular formula C13H17NO4S2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 2-cyclohexylsulfanyl-5-sulfamoylbenzoic acid.
| Compound Name | 2-cyclohexylsulfanyl-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 60872682 |
| Molecular Formula | C13H17NO4S2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.06 |
| IUPAC Name | 2-cyclohexylsulfanyl-5-sulfamoylbenzoic acid |
| SMILES | NS(=O)(=O)c1ccc(SC2CCCCC2)c(C(=O)O)c1 |
| InChI | InChI=1S/C13H17NO4S2/c14-20(17,18)10-6-7-12(11(8-10)13(15)16)19-9-4-2-1-3-5-9/h6-9H,1-5H2,(H,15,16)(H2,14,17,18) |
| InChIKey | RUPKODOOEFYAEP-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |