C10H13NO6S3 — CID 63660072
2-(2-methylsulfonylethylsulfanyl)-5-sulfamoylbenzoic acid (PubChem CID 63660072) has the molecular formula C10H13NO6S3 and a molecular weight of 339.42 g/mol. Its IUPAC name is 2-(2-methylsulfonylethylsulfanyl)-5-sulfamoylbenzoic acid.
| Compound Name | 2-(2-methylsulfonylethylsulfanyl)-5-sulfamoylbenzoic acid |
|---|---|
| PubChem CID | 63660072 |
| Molecular Formula | C10H13NO6S3 |
| Molecular Weight | 339.42 g/mol |
| Exact Mass | 338.99 |
| IUPAC Name | 2-(2-methylsulfonylethylsulfanyl)-5-sulfamoylbenzoic acid |
| SMILES | CS(=O)(=O)CCSc1ccc(S(N)(=O)=O)cc1C(=O)O |
| InChI | InChI=1S/C10H13NO6S3/c1-19(14,15)5-4-18-9-3-2-7(20(11,16)17)6-8(9)10(12)13/h2-3,6H,4-5H2,1H3,(H,12,13)(H2,11,16,17) |
| InChIKey | FBKDTRBVZWGUIL-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 131.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.42 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |