C10H11BrO4S2 — CID 107282695
2-bromo-4-(2-methylsulfonylethylsulfanyl)benzoic acid (PubChem CID 107282695) has the molecular formula C10H11BrO4S2 and a molecular weight of 339.23 g/mol. Its IUPAC name is 2-bromo-4-(2-methylsulfonylethylsulfanyl)benzoic acid.
| Compound Name | 2-bromo-4-(2-methylsulfonylethylsulfanyl)benzoic acid |
|---|---|
| PubChem CID | 107282695 |
| Molecular Formula | C10H11BrO4S2 |
| Molecular Weight | 339.23 g/mol |
| Exact Mass | 337.93 |
| IUPAC Name | 2-bromo-4-(2-methylsulfonylethylsulfanyl)benzoic acid |
| SMILES | CS(=O)(=O)CCSc1ccc(C(=O)O)c(Br)c1 |
| InChI | InChI=1S/C10H11BrO4S2/c1-17(14,15)5-4-16-7-2-3-8(10(12)13)9(11)6-7/h2-3,6H,4-5H2,1H3,(H,12,13) |
| InChIKey | OYAFZPZJKXSMCP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.23 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |