C14H20O4S2 — CID 106721901
5-(2-tert-butylsulfonylethylsulfanyl)-2-methylbenzoic acid (PubChem CID 106721901) has the molecular formula C14H20O4S2 and a molecular weight of 316.44 g/mol. Its IUPAC name is 5-(2-tert-butylsulfonylethylsulfanyl)-2-methylbenzoic acid.
| Compound Name | 5-(2-tert-butylsulfonylethylsulfanyl)-2-methylbenzoic acid |
|---|---|
| PubChem CID | 106721901 |
| Molecular Formula | C14H20O4S2 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | 5-(2-tert-butylsulfonylethylsulfanyl)-2-methylbenzoic acid |
| SMILES | Cc1ccc(SCCS(=O)(=O)C(C)(C)C)cc1C(=O)O |
| InChI | InChI=1S/C14H20O4S2/c1-10-5-6-11(9-12(10)13(15)16)19-7-8-20(17,18)14(2,3)4/h5-6,9H,7-8H2,1-4H3,(H,15,16) |
| InChIKey | WPXQVZXJOPJTLJ-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |