C17H16F3NO2S2 — CID 143163130
2-methyl-5-[2-[4-(trifluoromethyl)phenyl]sulfanylethylamino]sulfanylbenzoic acid (PubChem CID 143163130) has the molecular formula C17H16F3NO2S2 and a molecular weight of 387.45 g/mol. Its IUPAC name is 2-methyl-5-[2-[4-(trifluoromethyl)phenyl]sulfanylethylamino]sulfanylbenzoic acid.
| Compound Name | 2-methyl-5-[2-[4-(trifluoromethyl)phenyl]sulfanylethylamino]sulfanylbenzoic acid |
|---|---|
| PubChem CID | 143163130 |
| Molecular Formula | C17H16F3NO2S2 |
| Molecular Weight | 387.45 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 2-methyl-5-[2-[4-(trifluoromethyl)phenyl]sulfanylethylamino]sulfanylbenzoic acid |
| SMILES | Cc1ccc(SNCCSc2ccc(C(F)(F)F)cc2)cc1C(=O)O |
| InChI | InChI=1S/C17H16F3NO2S2/c1-11-2-5-14(10-15(11)16(22)23)25-21-8-9-24-13-6-3-12(4-7-13)17(18,19)20/h2-7,10,21H,8-9H2,1H3,(H,22,23) |
| InChIKey | YYQBADIDPJBNSA-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|