C11H17Cl2F3N2S — CID 69275084
N'-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]ethane-1,2-diamine;dihydrochloride (PubChem CID 69275084) has the molecular formula C11H17Cl2F3N2S and a molecular weight of 337.24 g/mol. Its IUPAC name is N'-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]ethane-1,2-diamine;dihydrochloride.
| Compound Name | N'-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]ethane-1,2-diamine;dihydrochloride |
|---|---|
| PubChem CID | 69275084 |
| Molecular Formula | C11H17Cl2F3N2S |
| Molecular Weight | 337.24 g/mol |
| Exact Mass | 336.04 |
| IUPAC Name | N'-[2-[4-(trifluoromethyl)phenyl]sulfanylethyl]ethane-1,2-diamine;dihydrochloride |
| SMILES | Cl.Cl.NCCNCCSc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H15F3N2S.2ClH/c12-11(13,14)9-1-3-10(4-2-9)17-8-7-16-6-5-15;;/h1-4,16H,5-8,15H2;2*1H |
| InChIKey | SZPKWHHSMRVVGF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.24 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|