C18H25NS2 — CID 63515463
N-[2-(4-tert-butylphenyl)sulfanylethyl]-2-thiophen-3-ylethanamine (PubChem CID 63515463) has the molecular formula C18H25NS2 and a molecular weight of 319.54 g/mol. Its IUPAC name is N-[2-(4-tert-butylphenyl)sulfanylethyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[2-(4-tert-butylphenyl)sulfanylethyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 63515463 |
| Molecular Formula | C18H25NS2 |
| Molecular Weight | 319.54 g/mol |
| Exact Mass | 319.14 |
| IUPAC Name | N-[2-(4-tert-butylphenyl)sulfanylethyl]-2-thiophen-3-ylethanamine |
| SMILES | CC(C)(C)c1ccc(SCCNCCc2ccsc2)cc1 |
| InChI | InChI=1S/C18H25NS2/c1-18(2,3)16-4-6-17(7-5-16)21-13-11-19-10-8-15-9-12-20-14-15/h4-7,9,12,14,19H,8,10-11,13H2,1-3H3 |
| InChIKey | OJBPKKNNSCVGJQ-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.54 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|