C13H23NS2 — CID 107757303
N-[2-(3-methylbutan-2-ylsulfanyl)ethyl]-2-thiophen-3-ylethanamine (PubChem CID 107757303) has the molecular formula C13H23NS2 and a molecular weight of 257.47 g/mol. Its IUPAC name is N-[2-(3-methylbutan-2-ylsulfanyl)ethyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[2-(3-methylbutan-2-ylsulfanyl)ethyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 107757303 |
| Molecular Formula | C13H23NS2 |
| Molecular Weight | 257.47 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | N-[2-(3-methylbutan-2-ylsulfanyl)ethyl]-2-thiophen-3-ylethanamine |
| SMILES | CC(C)C(C)SCCNCCc1ccsc1 |
| InChI | InChI=1S/C13H23NS2/c1-11(2)12(3)16-9-7-14-6-4-13-5-8-15-10-13/h5,8,10-12,14H,4,6-7,9H2,1-3H3 |
| InChIKey | ZDZGZGAXPZHLNW-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.47 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|