C15H21N3S2 — CID 65041526
2-thiophen-3-yl-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine (PubChem CID 65041526) has the molecular formula C15H21N3S2 and a molecular weight of 307.49 g/mol. Its IUPAC name is 2-thiophen-3-yl-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine.
| Compound Name | 2-thiophen-3-yl-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine |
|---|---|
| PubChem CID | 65041526 |
| Molecular Formula | C15H21N3S2 |
| Molecular Weight | 307.49 g/mol |
| Exact Mass | 307.12 |
| IUPAC Name | 2-thiophen-3-yl-N-[2-(4,5,6-trimethylpyrimidin-2-yl)sulfanylethyl]ethanamine |
| SMILES | Cc1nc(SCCNCCc2ccsc2)nc(C)c1C |
| InChI | InChI=1S/C15H21N3S2/c1-11-12(2)17-15(18-13(11)3)20-9-7-16-6-4-14-5-8-19-10-14/h5,8,10,16H,4,6-7,9H2,1-3H3 |
| InChIKey | FMWPUCROXQWALS-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.49 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|