C15H22N4S2 — CID 62576481
N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethyl]-2-thiophen-3-ylethanamine (PubChem CID 62576481) has the molecular formula C15H22N4S2 and a molecular weight of 322.50 g/mol. Its IUPAC name is N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethyl]-2-thiophen-3-ylethanamine.
| Compound Name | N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethyl]-2-thiophen-3-ylethanamine |
|---|---|
| PubChem CID | 62576481 |
| Molecular Formula | C15H22N4S2 |
| Molecular Weight | 322.50 g/mol |
| Exact Mass | 322.13 |
| IUPAC Name | N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethyl]-2-thiophen-3-ylethanamine |
| SMILES | c1cc(CCNCCSc2nnc3n2CCCCC3)cs1 |
| InChI | InChI=1S/C15H22N4S2/c1-2-4-14-17-18-15(19(14)9-3-1)21-11-8-16-7-5-13-6-10-20-12-13/h6,10,12,16H,1-5,7-9,11H2 |
| InChIKey | BBBQAGWKUACCPR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.50 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|