C14H24N4S — CID 103068265
N-propyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)prop-2-en-1-amine (PubChem CID 103068265) has the molecular formula C14H24N4S and a molecular weight of 280.44 g/mol. Its IUPAC name is N-propyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)prop-2-en-1-amine.
| Compound Name | N-propyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)prop-2-en-1-amine |
|---|---|
| PubChem CID | 103068265 |
| Molecular Formula | C14H24N4S |
| Molecular Weight | 280.44 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | N-propyl-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanylmethyl)prop-2-en-1-amine |
| SMILES | C=C(CNCCC)CSc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C14H24N4S/c1-3-8-15-10-12(2)11-19-14-17-16-13-7-5-4-6-9-18(13)14/h15H,2-11H2,1H3 |
| InChIKey | DTSHKMNCPUPSNS-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.44 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|