C14H26N4S — CID 62578362
3-methyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethyl]butan-1-amine (PubChem CID 62578362) has the molecular formula C14H26N4S and a molecular weight of 282.46 g/mol. Its IUPAC name is 3-methyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethyl]butan-1-amine.
| Compound Name | 3-methyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethyl]butan-1-amine |
|---|---|
| PubChem CID | 62578362 |
| Molecular Formula | C14H26N4S |
| Molecular Weight | 282.46 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 3-methyl-N-[2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)ethyl]butan-1-amine |
| SMILES | CC(C)CCNCCSc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C14H26N4S/c1-12(2)7-8-15-9-11-19-14-17-16-13-6-4-3-5-10-18(13)14/h12,15H,3-11H2,1-2H3 |
| InChIKey | JTGHYCJREGEEPW-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.46 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|