C13H23N5OS — CID 77062413
N'-hydroxy-2,2-dimethyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)butanimidamide (PubChem CID 77062413) has the molecular formula C13H23N5OS and a molecular weight of 297.43 g/mol. Its IUPAC name is N'-hydroxy-2,2-dimethyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)butanimidamide.
| Compound Name | N'-hydroxy-2,2-dimethyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)butanimidamide |
|---|---|
| PubChem CID | 77062413 |
| Molecular Formula | C13H23N5OS |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N'-hydroxy-2,2-dimethyl-4-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)butanimidamide |
| SMILES | CC(C)(CCSc1nnc2n1CCCCC2)C(N)=NO |
| InChI | InChI=1S/C13H23N5OS/c1-13(2,11(14)17-19)7-9-20-12-16-15-10-6-4-3-5-8-18(10)12/h19H,3-9H2,1-2H3,(H2,14,17) |
| InChIKey | KWILTBQEHYAQJE-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|