C15H28N4S — CID 64649701
N-ethyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)hexan-2-amine (PubChem CID 64649701) has the molecular formula C15H28N4S and a molecular weight of 296.48 g/mol. Its IUPAC name is N-ethyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)hexan-2-amine.
| Compound Name | N-ethyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)hexan-2-amine |
|---|---|
| PubChem CID | 64649701 |
| Molecular Formula | C15H28N4S |
| Molecular Weight | 296.48 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | N-ethyl-6-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-ylsulfanyl)hexan-2-amine |
| SMILES | CCNC(C)CCCCSc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C15H28N4S/c1-3-16-13(2)9-6-8-12-20-15-18-17-14-10-5-4-7-11-19(14)15/h13,16H,3-12H2,1-2H3 |
| InChIKey | MSTHICAHVIACAL-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.48 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|