C12H14BrN3S2 — CID 71894607
3-[(5-bromothiophen-3-yl)methylsulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 71894607) has the molecular formula C12H14BrN3S2 and a molecular weight of 344.30 g/mol. Its IUPAC name is 3-[(5-bromothiophen-3-yl)methylsulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[(5-bromothiophen-3-yl)methylsulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 71894607 |
| Molecular Formula | C12H14BrN3S2 |
| Molecular Weight | 344.30 g/mol |
| Exact Mass | 342.98 |
| IUPAC Name | 3-[(5-bromothiophen-3-yl)methylsulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | Brc1cc(CSc2nnc3n2CCCCC3)cs1 |
| InChI | InChI=1S/C12H14BrN3S2/c13-10-6-9(7-17-10)8-18-12-15-14-11-4-2-1-3-5-16(11)12/h6-7H,1-5,8H2 |
| InChIKey | JJKVHAPWLJPOFI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |