C13H15ClN4S — CID 79037531
3-[(6-chloro-2-pyridinyl)methylsulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine (PubChem CID 79037531) has the molecular formula C13H15ClN4S and a molecular weight of 294.81 g/mol. Its IUPAC name is 3-[(6-chloro-2-pyridinyl)methylsulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine.
| Compound Name | 3-[(6-chloro-2-pyridinyl)methylsulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
|---|---|
| PubChem CID | 79037531 |
| Molecular Formula | C13H15ClN4S |
| Molecular Weight | 294.81 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | 3-[(6-chloro-2-pyridinyl)methylsulfanyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepine |
| SMILES | Clc1cccc(CSc2nnc3n2CCCCC3)n1 |
| InChI | InChI=1S/C13H15ClN4S/c14-11-6-4-5-10(15-11)9-19-13-17-16-12-7-2-1-3-8-18(12)13/h4-6H,1-3,7-9H2 |
| InChIKey | DJBDKAXPLXGEPA-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.81 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|